For research use only. Not for therapeutic Use.
AGI-43192（Cat No.:I043988）is a selective small molecule inhibitor designed to target specific enzymes and signaling pathways involved in cellular regulation and cancer progression. It works by modulating key molecular interactions, particularly those that affect tumor cell growth, survival, and metastasis. AGI-43192 has shown promise in preclinical studies for its ability to inhibit kinases and other crucial factors that drive cancerous transformations. Its potential applications in oncology research are significant, providing a tool for developing targeted therapies aimed at halting tumor development and improving treatment options for cancer patients.
| CAS Number | 2377491-54-6 |
| Synonyms | 8-(4-chlorophenyl)-6-(2-methylindazol-5-yl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one |
| Molecular Formula | C23H16ClF3N6O |
| Purity | ≥95% |
| IUPAC Name | 8-(4-chlorophenyl)-6-(2-methylindazol-5-yl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C23H16ClF3N6O/c1-32-10-14-8-17(6-7-18(14)31-32)33-11-15-9-28-22(29-12-23(25,26)27)30-20(15)19(21(33)34)13-2-4-16(24)5-3-13/h2-11H,12H2,1H3,(H,29,30) |
| InChIKey | XXCYDSDPIJJBSI-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=C(C=CC2=N1)N3C=C4C=NC(=NC4=C(C3=O)C5=CC=C(C=C5)Cl)NCC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
