For research use only. Not for therapeutic Use.
AG1557（Cat No.:I001487）is a potent and selective inhibitor of epidermal growth factor receptor (EGFR) tyrosine kinase, originally developed as a research compound. By blocking EGFR autophosphorylation, it disrupts downstream signaling pathways such as MAPK and PI3K/AKT, which are critical for cell proliferation and survival. AG1557 has demonstrated antiproliferative activity against various cancer cell lines, particularly those with EGFR overexpression. Its ability to impair tumor growth highlights the therapeutic potential of EGFR inhibition. AG1557 remains an important tool compound for studying receptor tyrosine kinase signaling and cancer biology.
| CAS Number | 189290-58-2 |
| Synonyms | N-(3-iodophenyl)-6,7-dimethoxyquinazolin-4-amine |
| Molecular Formula | C16H14IN3O2 |
| Purity | ≥95% |
| IUPAC Name | N-(3-iodophenyl)-6,7-dimethoxyquinazolin-4-amine |
| InChI | InChI=1S/C16H14IN3O2/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | FGCLAQLIXMAIHT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)I)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
