For research use only. Not for therapeutic Use.
Afloqualone (Cat.No:I004100) is a quinazolinone derivative that acts as a central nervous system depressant. It was used as a sedative and muscle relaxant, but due to its potential for abuse and dependence, it is no longer used in clinical practice. It acts as a GABA-A receptor agonist and has similar effects to barbiturates.
| CAS Number | 56287-74-2 |
| Molecular Formula | C16H14FN3O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO:33mg/mL |
| Storage | Store at 4°C |
| IUPAC Name | 6-amino-2-(fluoromethyl)-3-(2-methylphenyl)quinazolin-4-one |
| InChI | InChI=1S/C16H14FN3O/c1-10-4-2-3-5-14(10)20-15(9-17)19-13-7-6-11(18)8-12(13)16(20)21/h2-8H,9,18H2,1H3 |
| InChIKey | VDOSWXIDETXFET-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=NC3=C(C2=O)C=C(C=C3)N)CF |
| Reference | <p style=/line-height:25px/> </p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |