For research use only. Not for therapeutic Use.
N-<wbr></wbr>acetyl-<wbr></wbr>S-<wbr></wbr>farnesyl-<wbr></wbr>L-<wbr></wbr>Cysteine is a synthetic substrate for the isoprenylated protein methyltransferase (also known as S-<wbr></wbr>adenosylmethionine-<wbr></wbr>dependent methyltransferase). Because it is able to serve as a substrate for the methyltransferase, it effectively functions as an inhibitor of methylation of endogenous isoprenylated proteins.
CAS Number | 135304-07-3 |
Synonyms | AFC |
Molecular Formula | C20H33NO3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-2-acetamido-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
InChI | InChI=1S/C20H33NO3S/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-25-14-19(20(23)24)21-18(5)22/h8,10,12,19H,6-7,9,11,13-14H2,1-5H3,(H,21,22)(H,23,24)/b16-10+,17-12+/t19-/m0/s1 |
InChIKey | XTURYZYJYQRJDO-BNAHBJSTSA-N |
SMILES | CC(=CCCC(=CCCC(=CCSCC(C(=O)O)NC(=O)C)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |