For research use only. Not for therapeutic Use.
ADPM06（Cat No.:I001234）is a synthetic photosensitizer developed for use in photodynamic therapy (PDT), a minimally invasive treatment that combines light, oxygen, and a photosensitive compound to destroy cancer cells. ADPM06 belongs to the class of bacteriochlorin derivatives, characterized by strong absorption in the near-infrared region, allowing deeper tissue penetration. Upon light activation, it generates reactive oxygen species (ROS), leading to targeted oxidative damage and cell death. ADPM06 has shown promise in preclinical models for treating solid tumors due to its high phototoxicity, selectivity, and favorable pharmacokinetic properties, making it a candidate for advanced PDT applications.
| CAS Number | 490035-90-0 |
| Molecular Formula | C34H24BBr2F2N3O2 |
| Purity | ≥95% |
| IUPAC Name | 5,11-dibromo-2,2-difluoro-4,12-bis(4-methoxyphenyl)-6,10-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| InChI | InChI=1S/C34H24BBr2F2N3O2/c1-43-25-17-13-23(14-18-25)31-29(36)27(21-9-5-3-6-10-21)33-40-34-28(22-11-7-4-8-12-22)30(37)32(42(34)35(38,39)41(31)33)24-15-19-26(44-2)20-16-24/h3-20H,1-2H3 |
| InChIKey | YVKIKMDAXWFEJI-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=C(C(=C2N=C3[N+]1=C(C(=C3C4=CC=CC=C4)Br)C5=CC=C(C=C5)OC)C6=CC=CC=C6)Br)C7=CC=C(C=C7)OC)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
