For research use only. Not for therapeutic Use.
Adenosine 5′-monophosphate sodium salt(Cat No.:M053057) is a bioactive compound with significant physiological importance. Its mode of action involves serving as a sodium salt of adenosine 5′-monophosphate (AMP), a nucleotide that plays a crucial role in cellular energy metabolism. AMP is an essential component of various enzymatic reactions within the body, participating in processes like signal transduction and protein synthesis. This compound finds widespread application in research and biotechnological studies as a nucleotide source or a signaling molecule. Additionally, it is utilized in pharmaceutical formulations and nutritional supplements.
CAS Number | 13474-03-8 |
Molecular Formula | C10H13N5NaO7P |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | disodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
InChI | InChI=1S/C10H14N5O7P.2Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);;/q;2*+1/p-2/t4-,6-,7-,10-;;/m1../s1 |
InChIKey | QGXLVXZRPRRCRP-IDIVVRGQSA-L |
SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])[O-])O)O)N.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |