Home
>
Reference Standards>Nucleoside Antimetabolite/Analog> Adenosine, N-benzoyl-5/'-O-[bis(4-Methoxyphenyl)phenylMethyl]-2/'-deoxy-2/'-fluoro-
For research use only. Not for therapeutic Use.
Adenosine, N-benzoyl-5/’-O-[bis(4-Methoxyphenyl)phenylMethyl]-2/’-deoxy-2/’-fluoro-(Cat No.:M139196)is a modified nucleoside analog designed for advanced biochemical research. Its unique structure, featuring a fluoro substitution and bulky protecting groups, enhances its stability and interaction with biological targets, making it valuable for studying nucleic acid synthesis and enzyme function. This compound is often used in the development of antiviral and anticancer agents, as it mimics natural nucleosides while offering improved binding properties. Its versatility in isotope labeling makes it a critical tool for drug discovery and molecular biology studies.
| CAS Number | 136834-21-4 |
| Molecular Formula | C38H34FN5O6 |
| Purity | ≥95% |
| Target | DNA/RNA Synthesis |
| Storage | Store at -20°C |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]purin-6-yl]benzamide |
| InChI | InChI=1S/C38H34FN5O6/c1-47-28-17-13-26(14-18-28)38(25-11-7-4-8-12-25,27-15-19-29(48-2)20-16-27)49-21-30-33(45)31(39)37(50-30)44-23-42-32-34(40-22-41-35(32)44)43-36(46)24-9-5-3-6-10-24/h3-20,22-23,30-31,33,37,45H,21H2,1-2H3,(H,40,41,43,46)/t30-,31-,33-,37-/m1/s1 |
| InChIKey | DDOOVEXTSRBCMU-VYUOYPLNSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@@H]4[C@H]([C@H]([C@@H](O4)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |