For research use only. Not for therapeutic Use.
Adenine phosphate(Cat No.:L015111)is a high-purity nucleotide essential in biochemical and pharmaceutical research. It is a key component in the synthesis of nucleic acids, playing a crucial role in various cellular processes, including energy transfer, signal transduction, and enzymatic reactions. Adenine phosphate is particularly valuable in studies related to DNA and RNA synthesis, as well as in the development of therapeutic agents targeting nucleotide metabolism. Its reliable performance makes Adenine phosphate indispensable for advanced research in molecular biology, genetics, and drug development.
CAS Number | 52175-10-7 |
Molecular Formula | C5H8N5O4P |
Purity | ≥95% |
IUPAC Name | phosphoric acid;7H-purin-6-amine |
InChI | InChI=1S/C5H5N5.H3O4P/c6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h1-2H,(H3,6,7,8,9,10);(H3,1,2,3,4) |
InChIKey | CCHNOBQMQBSRHQ-UHFFFAOYSA-N |
SMILES | C1=NC2=NC=NC(=C2N1)N.OP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |