For research use only. Not for therapeutic Use.
ADAMTS-5-IN-3（Cat No.:I044020）is a small molecule inhibitor targeting ADAMTS-5 (A Disintegrin and Metalloproteinase with Thrombospondin Motifs 5), an enzyme involved in the breakdown of extracellular matrix components, particularly aggrecan. ADAMTS-5 plays a key role in the pathogenesis of osteoarthritis and other inflammatory conditions by degrading cartilage. By inhibiting ADAMTS-5, ADAMTS-5-IN-3 aims to prevent cartilage degradation, providing potential therapeutic benefits in treating osteoarthritis and other diseases involving cartilage damage. This compound is being studied for its ability to preserve joint health and reduce inflammation in musculoskeletal diseases.
| CAS Number | 2688733-96-0 |
| Synonyms | (5S)-5-cyclopropyl-5-[3-[(5R)-7,8-dichloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| Molecular Formula | C20H23Cl2N3O3 |
| Purity | ≥95% |
| IUPAC Name | (5S)-5-cyclopropyl-5-[3-[(5R)-7,8-dichloro-5-methyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| InChI | InChI=1S/C20H23Cl2N3O3/c1-11-10-25(7-5-12-8-15(21)16(22)9-14(11)12)17(26)4-6-20(13-2-3-13)18(27)23-19(28)24-20/h8-9,11,13H,2-7,10H2,1H3,(H2,23,24,27,28)/t11-,20-/m0/s1 |
| InChIKey | LBFZDWQGADLLKS-YBTHPKLGSA-N |
| SMILES | C[C@H]1CN(CCC2=CC(=C(C=C12)Cl)Cl)C(=O)CC[C@@]3(C(=O)NC(=O)N3)C4CC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
