For research use only. Not for therapeutic Use.
Acivicin hydrochloride（Cat No.:I044747）is a synthetic analog of glutamine that functions as an irreversible inhibitor of γ-glutamyl transpeptidase and several glutamine-dependent amidotransferases. It interferes with nucleotide and amino acid biosynthesis, making it a valuable tool in cancer research and biochemical studies of nitrogen metabolism. Acivicin exhibits antitumor, antimicrobial, and antiparasitic properties, and has been explored for its potential in chemotherapy. The hydrochloride salt form enhances its solubility and stability for in vitro and in vivo applications. It is commonly used to investigate glutamine metabolism and enzyme inhibition mechanisms.
| CAS Number | 161922-40-3 |
| Synonyms | (2S)-2-amino-2-[(5S)-3-chloro-4,5-dihydro-1,2-oxazol-5-yl]acetic acid;hydrochloride |
| Molecular Formula | C5H8Cl2N2O3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-2-[(5S)-3-chloro-4,5-dihydro-1,2-oxazol-5-yl]acetic acid;hydrochloride |
| InChI | InChI=1S/C5H7ClN2O3.ClH/c6-3-1-2(11-8-3)4(7)5(9)10;/h2,4H,1,7H2,(H,9,10);1H/t2-,4-;/m0./s1 |
| InChIKey | IXBPTDHBIYEQHX-QYEIVYHBSA-N |
| SMILES | C1[C@H](ON=C1Cl)[C@@H](C(=O)O)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
