For research use only. Not for therapeutic Use.
Acetyl-d3 Chloride is a deuterated form of acetyl chloride, with three deuterium atoms incorporated into the acetyl group. This high-purity isotopically labeled compound is essential for research in organic chemistry, particularly in the study of acetylation reactions, synthetic methodologies, and isotope labeling. Acetyl-d3 Chloride is particularly valuable for investigating reaction mechanisms, kinetic isotope effects, and the behavior of acetylating agents in various chemical processes. The deuterium labeling allows for precise tracking and analysis in NMR spectroscopy and mass spectrometry, providing enhanced accuracy in tracing the incorporation of the acetyl group in organic synthesis. This compound is a critical tool for researchers focused on the synthesis of labeled compounds, the study of reaction dynamics, and the development of new synthetic routes, offering reliable and consistent results in diverse experimental applications.
| CAS Number | 19259-90-6 |
| Synonyms | Acetic Acid-d3 Chloride; Acetic-d3 Chloride; Ethanoyl-d3 Chloride |
| Molecular Formula | C2H3ClO |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 2,2,2-trideuterioacetyl chloride |
| InChI | InChI=1S/C2H3ClO/c1-2(3)4/h1H3/i1D3 |
| InChIKey | WETWJCDKMRHUPV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |