Acetyl coenzyme A sodium salt (Cat No.:M001764) serves as a crucial metabolic intermediate in various cellular processes. It plays a central role in glycolysis by converting pyruvate into the tricarboxylic acid (TCA) cycle, which is essential for energy production. Acetyl Coenzyme A is also a key precursor for lipid synthesis and acts as the primary source for acetylation reactions. Additionally, it acts as a potent allosteric activator of pyruvate carboxylase (PC), an enzyme involved in the production of oxaloacetate.
| Catalog Number | M001764 |
| CAS Number | 102029-73-2 |
| Molecular Formula | C23H38N7NaO17P3S |
| Purity | 95% |
| Storage | -20°C |
| InChI | InChI=1S/C23H38N7O17P3S.Na/c1-12(31)51-7-6-25-14(32)4-5-26-21(35)18(34)23(2,3)9-44-50(41,42)47-49(39,40)43-8-13-17(46-48(36,37)38)16(33)22(45-13)30-11-29-15-19(24)27-10-28-20(15)30;/h10-11,13,16-18,22,33-34H,4-9H2,1-3H3,(H,25,32)(H,26,35)(H,39,40)(H,41,42)(H2,24,27,28)(H2,36,37,38); |
| InChIKey | XGCDESRMLMCTPI-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O.[Na] |
