For research use only. Not for therapeutic Use.
Acetone (Cat No.: R020206) is a colorless, volatile, and flammable liquid with the chemical formula C₃H₆O. It is the simplest and most widely used ketone, characterized by a sweet, pungent odor. Acetone is highly miscible with water and many organic solvents, making it an effective cleaning agent and solvent in laboratories, cosmetics, and industrial applications. It is commonly used in nail polish remover, paint thinners, and plastics production. Acetone is also produced naturally in the human body during fat metabolism and ketosis.
| CAS Number | 67-64-1 |
| Synonyms | Methyl Ketone; Dimethyl Ketone; Dimethylformaldehyde; NSC 135802; Propanone; Pyroacetic Ether; Taimax; β-Ketopropane; |
| Molecular Formula | C3H6O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | propan-2-one |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
| InChIKey | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| SMILES | CC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
