For research use only. Not for therapeutic Use.
Acetamiprid (Cat No.: R054445) is a systemic neonicotinoid insecticide with the molecular formula C₁₀H₁₁ClN₄. It acts as an agonist of nicotinic acetylcholine receptors in insects, causing paralysis and death. Widely used in agriculture, it controls sap-feeding pests such as aphids and whiteflies on crops like fruits, vegetables, and ornamentals. Acetamiprid is valued for its high potency, selectivity, and relatively low toxicity to mammals. Its water solubility and systemic action enable it to be absorbed by plants and protect them from pest infestations internally.
| CAS Number | 135410-20-7 |
| Synonyms | (1E)-N-[(6-chloro-3-pyridinyl)methyl]-N’-cyano-N-methylethanimidamide; ADA 06200; Assail; Intruder; Mospilan; NFK 17; NI 25; Piorun; Pristine; Prize; Stonkat; TD 2472; TD 2472-01; TD 2480; |
| Molecular Formula | C10H11ClN4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | Desiccate at RT |
| IUPAC Name | N-[(6-chloropyridin-3-yl)methyl]-N/'-cyano-N-methylethanimidamide |
| InChI | InChI=1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3 |
| InChIKey | WCXDHFDTOYPNIE-UHFFFAOYSA-N |
| SMILES | CC(=NC#N)N(C)CC1=CN=C(C=C1)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |