For research use only. Not for therapeutic Use.
Acanthoside B(CAT: R005031) is a chemical compound with significant applications in pharmaceutical and natural product chemistry. This compound is a natural product extracted from certain plant sources and is known for its potential medicinal properties. In pharmaceutical research, Acanthoside B is studied for its potential therapeutic effects, such as anti-inflammatory and antioxidant properties. Its organic chemistry relevance lies in the isolation and characterization of natural compounds from plant extracts.
CAS Number | 7374-79-0 |
Molecular Formula | C28H36O13 |
Purity | ≥95% |
Target | Plants |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C28H36O13/c1-34-16-5-12(6-17(35-2)21(16)30)25-14-10-39-26(15(14)11-38-25)13-7-18(36-3)27(19(8-13)37-4)41-28-24(33)23(32)22(31)20(9-29)40-28/h5-8,14-15,20,22-26,28-33H,9-11H2,1-4H3/t14-,15-,20+,22+,23-,24+,25+,26+,28-/m0/s1 |
InChIKey | WEKCEGQSIIQPAQ-IRBNZIFYSA-N |
SMILES | COC1=CC(=CC(=C1O)OC)C2C3COC(C3CO2)C4=CC(=C(C(=C4)OC)OC5C(C(C(C(O5)CO)O)O)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |