For research use only. Not for therapeutic Use.
AC-186（Cat No.:I000988）is a small molecule inhibitor that targets the protein tyrosine kinase, Fyn, which is involved in regulating cell signaling pathways related to immune response and inflammation. By inhibiting Fyn, AC-186 has shown potential in modulating inflammatory processes, making it a candidate for the treatment of autoimmune diseases, such as rheumatoid arthritis and multiple sclerosis. Additionally, AC-186 may offer therapeutic benefits in conditions where abnormal immune activation contributes to disease progression. Further research and clinical trials are needed to assess its safety, efficacy, and potential applications in treating inflammatory disorders.
| CAS Number | 1421854-16-1 |
| Synonyms | 4-[4,4-difluoro-1-(2-fluorophenyl)cyclohexyl]phenol |
| Molecular Formula | C18H17F3O |
| Purity | ≥95% |
| IUPAC Name | 4-[4,4-difluoro-1-(2-fluorophenyl)cyclohexyl]phenol |
| InChI | InChI=1S/C18H17F3O/c19-16-4-2-1-3-15(16)17(9-11-18(20,21)12-10-17)13-5-7-14(22)8-6-13/h1-8,22H,9-12H2 |
| InChIKey | HSMUKSLNDJOZQG-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(C2=CC=C(C=C2)O)C3=CC=CC=C3F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
