For research use only. Not for therapeutic Use.
AC-099 hydrochloride(Cat No.:I041130)is a chemical compound that has shown potential in preclinical research as a therapeutic agent, particularly in the field of oncology. It is a selective small molecule that targets specific proteins or signaling pathways involved in cancer cell proliferation, survival, and metastasis. By modulating these pathways, AC-099 hydrochloride may inhibit tumor growth and enhance the effects of other cancer treatments. Ongoing studies aim to assess its efficacy, safety, and mechanism of action in various cancer types, with the potential for its development as a targeted cancer therapy.
CAS Number | 849335-07-5 |
Synonyms | 2-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]guanidine;hydrochloride |
Molecular Formula | C9H9Cl2F3N4 |
Purity | ≥95% |
IUPAC Name | 2-[(E)-[4-chloro-3-(trifluoromethyl)phenyl]methylideneamino]guanidine;hydrochloride |
InChI | InChI=1S/C9H8ClF3N4.ClH/c10-7-2-1-5(4-16-17-8(14)15)3-6(7)9(11,12)13;/h1-4H,(H4,14,15,17);1H/b16-4+; |
InChIKey | OMYOUCJVJYJITH-CQCNNJTASA-N |
SMILES | C1=CC(=C(C=C1/C=N/N=C(N)N)C(F)(F)F)Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |