ABX464 (CAT: I000987) is a small molecule drug that has garnered significant attention for its potential antiviral and anti-inflammatory properties. It works by selectively inhibiting the production of viral RNA, thereby preventing the replication of certain viruses, including the human immunodeficiency virus (HIV). ABX464 also exhibits anti-inflammatory effects by modulating the expression of specific inflammatory genes. This dual mechanism of action makes ABX464 a promising candidate for the treatment of viral infections and inflammatory diseases. Ongoing clinical studies are exploring its efficacy and safety in various indications, including HIV/AIDS and inflammatory bowel disease.
Catalog Number | I000987 |
CAS Number | 1258453-75-6 |
Synonyms | ABX-464; SPL-464; ABX 464; SPL 464; ABX464; SPL464;8-chloro-N-(4-(trifluoromethoxy)phenyl)quinolin-2-amine |
Molecular Formula | C16H10ClF3N2O |
Purity | ≥95% |
Target | HIV replication inhibitor |
Solubility | Soluble in DMSO |
Storage | 0 - 4°Cfor short term (days to weeks), or -20 °C for long term (months). |
IUPAC Name | 8-chloro-N-[4-(trifluoromethoxy)phenyl]quinolin-2-amine |
InChI | InChI=1S/C16H10ClF3N2O/c17-13-3-1-2-10-4-9-14(22-15(10)13)21-11-5-7-12(8-6-11)23-16(18,19)20/h1-9H,(H,21,22) |
InChIKey | OZOGDCZJYVSUBR-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)Cl)N=C(C=C2)NC3=CC=C(C=C3)OC(F)(F)F |
Reference | 1: Berkhout B, van der Velden YU. ABX464: a good drug candidate instead of a |