For research use only. Not for therapeutic Use.
Adalimumab(Cat No.:M003575)is a monoclonal antibody that targets and inhibits tumor necrosis factor-alpha (TNF-α), a pro-inflammatory cytokine involved in various autoimmune conditions. By blocking TNF-α, adalimumab helps reduce inflammation and tissue damage in diseases such as rheumatoid arthritis, Crohn’s disease, psoriasis, and ankylosing spondylitis. It is administered via subcutaneous injection and has shown significant efficacy in managing chronic inflammatory conditions by modulating the immune response. While generally well-tolerated, adalimumab can increase the risk of infections, and patients require monitoring for potential side effects like injection site reactions and immune system suppression.
| CAS Number | 331731-18-1 |
| Synonyms | Adalimumab;D2E7;Humira;Immunoglobulin G1, anti-(human tumor necrosis factor) (human monoclonal D2E7 heavy chain), disulfide with human monoclonal D2E7 light chain, dimer;Unii-fys6T7F842 |
| Molecular Formula | C20H22N2O7S |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | Store at -20°C |
| IUPAC Name | 2-[[2-[[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylamino]benzoyl]amino]acetic acid |
| InChI | InChI=1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | BTGNGJJLZOIYID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |