For research use only. Not for therapeutic Use.
Abscisic acid(Cat No.:M065618)is a naturally occurring plant hormone that plays a crucial role in regulating various physiological processes, including seed dormancy, stress responses, and stomatal closure. It is particularly important in helping plants adapt to environmental stressors such as drought and cold. Abscisic acid is widely studied in agricultural research for its potential to improve crop resilience and enhance plant growth under challenging conditions. It also serves as a valuable tool in plant biotechnology and developmental biology for understanding plant-environment interactions. High purity ensures its effectiveness in research and agricultural applications.
| CAS Number | 14375-45-2 |
| Molecular Formula | C15H20O4 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7- |
| InChIKey | JLIDBLDQVAYHNE-LXGGSRJLSA-N |
| SMILES | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |