For research use only. Not for therapeutic Use.
ABP688（Cat No.:I011143）is a selective antagonist of the metabotropic glutamate receptor 5 (mGluR5), which plays a key role in the regulation of synaptic plasticity, neurotransmission, and various neurological functions. By blocking mGluR5, ABP688 is being investigated for its potential therapeutic applications in neurological disorders such as Parkinson’s disease, anxiety, depression, and schizophrenia. Preclinical studies suggest that ABP688 may help modulate glutamatergic signaling, which could reduce symptoms associated with these conditions. However, further clinical research is necessary to evaluate its safety, efficacy, and therapeutic potential for treating neuropsychiatric disorders.
| CAS Number | 924298-51-1 |
| Synonyms | (E)-N-methoxy-3-[2-(6-methylpyridin-2-yl)ethynyl]cyclohex-2-en-1-imine |
| Molecular Formula | C15H16N2O |
| Purity | ≥95% |
| IUPAC Name | (E)-N-methoxy-3-[2-(6-methylpyridin-2-yl)ethynyl]cyclohex-2-en-1-imine |
| InChI | InChI=1S/C15H16N2O/c1-12-5-3-7-14(16-12)10-9-13-6-4-8-15(11-13)17-18-2/h3,5,7,11H,4,6,8H2,1-2H3/b17-15+ |
| InChIKey | CNNZLFXCUQLKOB-BMRADRMJSA-N |
| SMILES | CC1=NC(=CC=C1)C#CC2=C/C(=N/OC)/CCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
