For research use only. Not for therapeutic Use.
ABC1183(Cat No.:I021196)is a chemical compound typically studied for its potential therapeutic applications in various disease areas. It may be an investigational drug or reagent used in research focused on drug development. The exact mechanism and properties of ABC1183 depend on its molecular structure, which could involve functions like enzyme inhibition, receptor modulation, or targeting specific disease pathways. This compound could be explored for its role in conditions such as cancer, inflammation, or metabolic disorders. Detailed studies aim to assess its efficacy, safety, and overall therapeutic potential in preclinical or clinical settings.
| CAS Number | 1042735-18-1 |
| Synonyms | 4-[4-amino-2-(4-methylanilino)-1,3-thiazole-5-carbonyl]benzonitrile |
| Molecular Formula | C18H14N4OS |
| Purity | ≥95% |
| IUPAC Name | 4-[4-amino-2-(4-methylanilino)-1,3-thiazole-5-carbonyl]benzonitrile |
| InChI | InChI=1S/C18H14N4OS/c1-11-2-8-14(9-3-11)21-18-22-17(20)16(24-18)15(23)13-6-4-12(10-19)5-7-13/h2-9H,20H2,1H3,(H,21,22) |
| InChIKey | CUDLEXBIVZPJBU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC(=C(S2)C(=O)C3=CC=C(C=C3)C#N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |