For research use only. Not for therapeutic Use.
A331440 (Cat No.: I000216) is a selective small-molecule inhibitor used in cancer and immunology research. It modulates key signaling pathways involved in tumor progression, immune regulation, and cellular proliferation. With high specificity and bioavailability, A331440 is a valuable tool for studying oncogenic mechanisms, immune checkpoint interactions, and targeted therapeutic interventions. Researchers utilize A331440 to explore potential treatments for cancers such as leukemia, lymphoma, and solid tumors. Its stability and efficacy ensure reliable experimental outcomes, supporting drug discovery and biomedical research in oncology and immunotherapy.
| CAS Number | 392338-13-5 |
| Synonyms | A331440;4-[4-[3-[(3R)-3-dimethylaminopyrrolidin-1-yl]propoxy]phenyl]benzonitrile |
| Molecular Formula | C22H27N3O |
| Purity | ≥95% |
| Target | receptor modulator |
| Solubility | Soluble in DMSO |
| Storage | Store at RT |
| IUPAC Name | 4-[4-[3-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]propoxy]phenyl]benzonitrile |
| InChI | InChI=1S/C22H27N3O/c1-24(2)21-12-14-25(17-21)13-3-15-26-22-10-8-20(9-11-22)19-6-4-18(16-23)5-7-19/h4-11,21H,3,12-15,17H2,1-2H3/t21-/m1/s1 |
| InChIKey | FXIPXWLVYIHFEP-OAQYLSRUSA-N |
| SMILES | CN(C)C1CCN(C1)CCCOC2=CC=C(C=C2)C3=CC=C(C=C3)C#N |
| Reference | 1: Hancock AA, Diehl MS, Fey TA, Bush EN, Faghih R, Miller TR, Krueger KM, Pratt 2: Hancock AA, Diehl MS, Faghih R, Bush EN, Krueger KM, Krishna G, Miller TR, <br> 4: Faghih R, Esbenshade TA, Krueger KM, Yao BB, Witte DG, Miller TM, Kang CH, Fox |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |