α-Selinine (Cat No.:C001059) is a natural alkaloid with a purity of over 85%. It belongs to the tropane alkaloid family and is found in certain plants and fungi. Its chemical formula is C15H23NO. α-Selinine has diverse pharmacological properties and may hold potential for medical and research applications. Caution should be taken while handling this compound due to its chemical nature.
| Catalog Number | C001059 |
| CAS Number | 473-13-2 |
| Synonyms | (2R,4aR,8aR)-4a,8-Dimethyl-2-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene; Eudesma-3,11-diene; α-Selinene; (-)-α-Selinene; Selina-3,11-diene; [2R-(2α,4aα,8aβ)]-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-2-(1-methylethenyl)naphthalene; α-Selinene, (-)-; (2R,4aR,8aR)-1,2,3,4,4a,5,6,8a-Octahydro-4a,8-dimethyl-2-(1-methylethenyl)naphthalene; |
| Molecular Formula | C₁₅H₂₄ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Hexane (Slightly) |
| Appearance | Colourless Oil |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | (3R,4aR,8aR)-5,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalene |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | OZQAPQSEYFAMCY-QLFBSQMISA-N |
| SMILES | CC1=CCCC2(C1CC(CC2)C(=C)C)C |
| Reference | Sacchetti, G., et al.: Food Chem., 91, 621 (2005); Bozin, B., et al.: J. Agric. Food Chem., 54, 1822 (2006); Kiralan, M., et al.: Nat. Prod. Res., 26, 132 (2012); |
