For research use only. Not for therapeutic Use.
A-908292(Cat No.:I043672)is a selective inhibitor of the enzyme phosphodiesterase 10A (PDE10A), a target involved in regulating the signaling pathways of cyclic nucleotides in the brain. By inhibiting PDE10A, A-908292 increases the levels of cyclic AMP and cyclic GMP, which play crucial roles in neuronal signaling, plasticity, and cognitive function. This compound has shown potential in preclinical studies for treating neuropsychiatric disorders, including schizophrenia and Parkinson’s disease, by improving cognitive symptoms and enhancing motor function. A-908292 represents a promising lead in the development of therapies targeting brain signaling pathways.
| CAS Number | 903886-95-3 |
| Synonyms | methyl N-[(2S)-4-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]but-3-yn-2-yl]carbamate |
| Molecular Formula | C18H20N2O4S |
| Purity | ≥95% |
| IUPAC Name | methyl N-[(2S)-4-[2-(4-propan-2-yloxyphenoxy)-1,3-thiazol-5-yl]but-3-yn-2-yl]carbamate |
| InChI | InChI=1S/C18H20N2O4S/c1-12(2)23-14-6-8-15(9-7-14)24-18-19-11-16(25-18)10-5-13(3)20-17(21)22-4/h6-9,11-13H,1-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | OLMPAYQFDVALIH-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C#CC1=CN=C(S1)OC2=CC=C(C=C2)OC(C)C)NC(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |