For research use only. Not for therapeutic Use.
A-784168（Cat No.:I010932）is a selective inhibitor of the protein kinase CK2, which is involved in regulating various cellular processes, including cell growth, survival, and apoptosis. By inhibiting CK2, A-784168 has shown potential in disrupting abnormal cell proliferation, particularly in cancer cells. This compound is being explored for its ability to suppress tumor growth, especially in cancers where CK2 is overactive. Preclinical studies have demonstrated its effectiveness in reducing tumor cell viability, though further research is needed to evaluate its clinical potential, safety, and effectiveness in cancer treatment.
| CAS Number | 824982-41-4 |
| Synonyms | 1-[3-(trifluoromethyl)pyridin-2-yl]-N-[4-(trifluoromethylsulfonyl)phenyl]-3,6-dihydro-2H-pyridine-4-carboxamide |
| Molecular Formula | C19H15F6N3O3S |
| Purity | ≥95% |
| IUPAC Name | 1-[3-(trifluoromethyl)pyridin-2-yl]-N-[4-(trifluoromethylsulfonyl)phenyl]-3,6-dihydro-2H-pyridine-4-carboxamide |
| InChI | InChI=1S/C19H15F6N3O3S/c20-18(21,22)15-2-1-9-26-16(15)28-10-7-12(8-11-28)17(29)27-13-3-5-14(6-4-13)32(30,31)19(23,24)25/h1-7,9H,8,10-11H2,(H,27,29) |
| InChIKey | SDUAWRFBHRAFBM-UHFFFAOYSA-N |
| SMILES | C1CN(CC=C1C(=O)NC2=CC=C(C=C2)S(=O)(=O)C(F)(F)F)C3=C(C=CC=N3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
