For research use only. Not for therapeutic Use.
9,9-Dimethyl-9H-fluoren-3-amine (Cat.No:L003661) is a pivotal compound in organic synthesis. Its unique structure, characterized by a fluorene backbone with an amino group, offers versatile reactivity. This compound serves as a valuable building block in the preparation of specialized materials, particularly in the field of organic electronics. Its significance lies in its role as a key intermediate for the synthesis of functional molecules, emphasizing its importance in contemporary chemical research and materials science applications.
| CAS Number | 1421789-14-1 |
| Molecular Formula | C15H15N |
| Purity | ≥95% |
| IUPAC Name | 9,9-dimethylfluoren-3-amine |
| InChI | InChI=1S/C15H15N/c1-15(2)13-6-4-3-5-11(13)12-9-10(16)7-8-14(12)15/h3-9H,16H2,1-2H3 |
| InChIKey | GAGIQOAHYUJVFT-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)N)C3=CC=CC=C31)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |