For research use only. Not for therapeutic Use.
9,9-Dihexylfluorene-2,7-diboronic acid(CAT: L017668) is a high-purity, functionalized fluorene derivative featuring boronic acid groups at the 2- and 7-positions and two hexyl chains at the 9-position. This versatile molecule serves as a critical building block in organic electronics and material science, particularly for the synthesis of conjugated polymers, light-emitting materials, and organic semiconductors. Its boronic acid groups enable targeted functionalization through Suzuki-Miyaura cross-coupling reactions, facilitating the development of advanced optoelectronic materials. The hexyl chains provide enhanced solubility and processability, making 9,9-Dihexylfluorene-2,7-diboronic acid ideal for precision-driven applications in OLEDs, OPVs, and other electronic devices.
| CAS Number | 203927-98-4 |
| Molecular Formula | C25H36B2O4 |
| Purity | ≥95% |
| IUPAC Name | (7-borono-9,9-dihexylfluoren-2-yl)boronic acid |
| InChI | InChI=1S/C25H36B2O4/c1-3-5-7-9-15-25(16-10-8-6-4-2)23-17-19(26(28)29)11-13-21(23)22-14-12-20(27(30)31)18-24(22)25/h11-14,17-18,28-31H,3-10,15-16H2,1-2H3 |
| InChIKey | QFWOJNOZWMHNTK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=C(C2(CCCCCC)CCCCCC)C=C(C=C3)B(O)O)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |