Home
>
Chemical Reagents>Heterocyclic Building Blocks> 9,9'-Bis([1,1'-biphenyl]-3-yl)-3,3'-bi-9H-carbazole
For research use only. Not for therapeutic Use.
9,9′-Bis([1,1′-biphenyl]-3-yl)-3,3′-bi-9H-carbazole (Cat.No:L004128) is a pivotal compound in materials science. Its unique structure, featuring a bi-carbazole core and biphenyl branches, imparts specialized electronic properties. This compound serves as a key component in the development of organic semiconductors, with applications in optoelectronic devices.
| CAS Number | 1352040-89-1 |
| Molecular Formula | C48H32N2 |
| Purity | ≥95% |
| IUPAC Name | 9-(3-phenylphenyl)-3-[9-(3-phenylphenyl)carbazol-3-yl]carbazole |
| InChI | InChI=1S/C48H32N2/c1-3-13-33(14-4-1)35-17-11-19-39(29-35)49-45-23-9-7-21-41(45)43-31-37(25-27-47(43)49)38-26-28-48-44(32-38)42-22-8-10-24-46(42)50(48)40-20-12-18-36(30-40)34-15-5-2-6-16-34/h1-32H |
| InChIKey | RQTORZWIAZFXNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N3C4=C(C=C(C=C4)C5=CC6=C(C=C5)N(C7=CC=CC=C76)C8=CC=CC(=C8)C9=CC=CC=C9)C1=CC=CC=C13 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |