For research use only. Not for therapeutic Use.
9,9-Bis(4-allyloxyphenyl)fluorene is an organic compound used in the synthesis of advanced materials, particularly in polymer chemistry and organic electronics. Its structure features a fluorene core with two allyloxyphenyl groups, which provide sites for further chemical reactions. This compound is commonly utilized in the production of light-emitting diodes (LEDs), photovoltaic cells, and other optoelectronic devices. Its rigid, conjugated framework enhances its thermal stability and photophysical properties, making it valuable for developing high-performance materials in electronic and display technologies.
| CAS Number | 142494-81-3 |
| Synonyms | 9,9-bis(4-allyloxyphenyl)fluorene |
| Molecular Formula | C31H26O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 9,9-bis(4-prop-2-enoxyphenyl)fluorene |
| InChI | InChI=1S/C31H26O2/c1-3-21-32-25-17-13-23(14-18-25)31(24-15-19-26(20-16-24)33-22-4-2)29-11-7-5-9-27(29)28-10-6-8-12-30(28)31/h3-20H,1-2,21-22H2 |
| InChIKey | OAGAWNXQZROGRJ-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)OCC=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |