For research use only. Not for therapeutic Use.
9,9′-(5-Bromo-1,3-phenylene)bis(9H-carbazole)(Cat No.:L026813)is a conjugated organic compound consisting of two 9H-carbazole units linked through a central 5-bromo-1,3-phenylene spacer. This molecule features a highly rigid and planar structure, offering excellent thermal and photochemical stability. The carbazole moieties contribute strong electron-donating and hole-transporting properties, making the compound valuable in organic electronics, particularly in OLEDs, OFETs, and photovoltaic materials. The bromine atom at the 5-position enables further functionalization via cross-coupling reactions, such as Suzuki or Stille, for tailored material design. Its extended π-conjugation promotes charge mobility and fluorescence, ideal for optoelectronic applications.
| CAS Number | 750573-24-1 |
| Molecular Formula | C30H19BrN2 |
| Purity | ≥95% |
| IUPAC Name | 9-(3-bromo-5-carbazol-9-ylphenyl)carbazole |
| InChI | InChI=1S/C30H19BrN2/c31-20-17-21(32-27-13-5-1-9-23(27)24-10-2-6-14-28(24)32)19-22(18-20)33-29-15-7-3-11-25(29)26-12-4-8-16-30(26)33/h1-19H |
| InChIKey | SJOKONNBSXFPSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC(=CC(=C4)Br)N5C6=CC=CC=C6C7=CC=CC=C75 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |