9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,3,6,7,14,15-hexaol (Cat.No:L003660) is a pivotal chemical compound with unique aromatic properties. Its distinctive structure lends itself to applications in materials science, particularly in the development of specialized polymers and organic semiconductors. This compound’s conjugated framework makes it a valuable building block for the creation of advanced materials, showcasing its significance in contemporary research and its role in advancing technologies across various industries.
Catalog Number | L003660 |
CAS Number | 1227256-04-3 |
Molecular Formula | C20H14O6 |
Purity | ≥95% |
IUPAC Name | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaene-4,5,11,12,17,18-hexol |
InChI | InChI=1S/C20H14O6/c21-13-1-7-8(2-14(13)22)20-11-5-17(25)15(23)3-9(11)19(7)10-4-16(24)18(26)6-12(10)20/h1-6,19-26H |
InChIKey | KCRLQRDIZWMUFI-UHFFFAOYSA-N |
SMILES | C1=C2C3C4=CC(=C(C=C4C(C2=CC(=C1O)O)C5=CC(=C(C=C35)O)O)O)O |