For research use only. Not for therapeutic Use.
9-OxoOD (9-Oxo-1,2,3,4-tetrahydro-1H-quinolin-2-one) is a quinoline derivative notable for its potential biological activities, including antitumor and antimicrobial properties. This compound features a ketone functionality, enhancing its reactivity and making it valuable in organic synthesis. Its unique structure allows for various modifications, contributing to the development of novel therapeutic agents. Researchers are exploring its applications in medicinal chemistry, particularly in the design of bioactive molecules and as a scaffold for further chemical transformations in drug discovery.
| CAS Number | 54232-59-6 |
| Synonyms | 9-KODE |
| Molecular Formula | C18H30O3 |
| Purity | ≥95% |
| Storage | -80°C |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+ |
| InChIKey | LUZSWWYKKLTDHU-ZJHFMPGASA-N |
| SMILES | CCCCC/C=CC=C/C(=O)CCCCCCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |