For research use only. Not for therapeutic Use.
9-Methoxyacridine is a heterocyclic compound featuring an acridine core with a methoxy group at the 9-position. It is widely used in pharmaceutical research, particularly as an intermediate in the synthesis of bioactive molecules. 9-Methoxyacridine has been studied for its antimalarial, anticancer, and antimicrobial properties due to its ability to interact with DNA by intercalation. This compound is also employed in the development of fluorescent dyes and probes for biological imaging, contributing to advancements in medicinal chemistry and molecular biology.
| CAS Number | 10228-90-7 |
| Molecular Formula | C14H11NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 9-methoxyacridine |
| InChI | InChI=1S/C14H11NO/c1-16-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H3 |
| InChIKey | ZHBWKWDAMIJZPW-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC=CC2=NC3=CC=CC=C31 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |