1. Home
  2. Product
  3. Catalysts and Ligands
  4. Photocatalysts
  5. 9-Mesityl-10-methylacridin-10-ium hexafluorophosphate

9-Mesityl-10-methylacridin-10-ium hexafluorophosphate - CAS 872205-11-3

9-Mesityl-10-methylacridin-10-ium hexafluorophosphate (Cat.No:L003726) is a significant chemical compound with diverse applications in materials science and catalysis. Its unique acridinium structure, featuring mesityl and methyl groups, imparts distinctive properties. This compound is employed as a key intermediate in the synthesis of specialized materials and as a catalyst in various organic transformations.

Catalog Number: L003726

CAS Number: 872205-11-3

Molecular Formula: C23H22F6NP

Molecular Weight:457.4

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C23H22F6NP
Molecular Weight457.4
Purity≥95%

Computed Descriptor

IUPAC Name10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium;hexafluorophosphate
InChIInChI=1S/C23H22N.F6P/c1-15-13-16(2)22(17(3)14-15)23-18-9-5-7-11-20(18)24(4)21-12-8-6-10-19(21)23;1-7(2,3,4,5)6/h5-14H,1-4H3;/q+1;-1
InChIKeyDZOVKULWDNOBBL-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C)C.F[P-](F)(F)(F)(F)F