9-Hydroxy benzopyrene is a metabolite of benzopyrene, a polycyclic aromatic hydrocarbon found in tobacco smoke, grilled meats, and other combustion processes. This hydroxylated derivative is formed through the action of cytochrome P450 enzymes in the liver. It is a highly reactive compound that can form DNA adducts and contribute to the carcinogenic effects of benzopyrene. Research on 9-hydroxy benzopyrene focuses on its genotoxicity, metabolism, and role in the initiation and progression of cancer.
| Catalog Number | R047701 |
| CAS Number | 17573-21-6 |
| Synonyms | Benzo[a]pyren-9-ol; 9-Hydroxybenzo[a]pyrene; |
| Molecular Formula | C20H12O |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | benzo[a]pyren-9-ol |
| InChI | InChI=1S/C20H12O/c21-16-8-6-14-10-15-5-4-12-2-1-3-13-7-9-17(18(14)11-16)20(15)19(12)13/h1-11,21H |
| InChIKey | OBBBXCAFTKLFGZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC5=C4C=C(C=C5)O)C=C2 |
