For research use only. Not for therapeutic Use.
9-Amino-6-chloro-2-methoxyacridine is an acridine derivative used in pharmaceutical research, particularly in the development of anticancer and antimicrobial agents. Its structure, featuring an acridine core with an amino group at position 9, a chlorine atom at position 6, and a methoxy group at position 2, gives it unique biological activity. This compound is known for its DNA-binding properties, making it valuable in studying DNA interactions and developing drugs that target cellular processes, such as replication and transcription, in cancer and microbial cells.
| CAS Number | 3548-09-2 |
| Synonyms | 6-chloro-2-methoxyacridin-9-amine |
| Molecular Formula | C14H11ClN2O |
| Purity | ≥95% |
| InChI | InChI=1S/C14H11ClN2O/c1-18-9-3-5-12-11(7-9)14(16)10-4-2-8(15)6-13(10)17-12/h2-7H,1H3,(H2,16,17) |
| InChIKey | IHHSSHCBRVYGJX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C3=C(C=C(C=C3)Cl)N=C2C=C1)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |