For research use only. Not for therapeutic Use.
9-(3-Bromophenyl)-9-phenyl-9H-fluorene(Cat No.:L010981)is a fluorene-based organic compound featuring a central 9H-fluorene core substituted with a phenyl group and a 3-bromophenyl group at the 9-position. Its rigid, conjugated tricyclic backbone provides excellent thermal and photochemical stability, making it valuable in organic electronics, particularly in OLEDs and photovoltaic materials. The bromine atom serves as a reactive site for cross-coupling reactions (e.g., Suzuki or Stille), enabling further functionalization. Its extended π-conjugation supports efficient charge transport, while the sterically hindered substituents improve solubility and film-forming properties for optoelectronic device fabrication.
| CAS Number | 1257251-75-4 |
| Molecular Formula | C25H17Br |
| Purity | ≥95% |
| IUPAC Name | 9-(3-bromophenyl)-9-phenylfluorene |
| InChI | InChI=1S/C25H17Br/c26-20-12-8-11-19(17-20)25(18-9-2-1-3-10-18)23-15-6-4-13-21(23)22-14-5-7-16-24(22)25/h1-17H |
| InChIKey | LWBYEDXZPBXTFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC(=CC=C5)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |