For research use only. Not for therapeutic Use.
9-(2-Phosphonylmethoxyethyl)-2,6-diaminopurine(Cat No.:M020026)is a bioactive purine derivative used in pharmaceutical research, primarily as a potential antiviral and anticancer agent. The compound features a phosphonylmethoxyethyl group, which enhances its ability to interact with cellular enzymes, particularly those involved in nucleic acid metabolism. This modification can improve the compound’s stability and potency. Due to its structural similarity to natural nucleotides, it is being investigated for its potential in nucleoside analog therapies, targeting specific enzymes in viral replication and cancer cell proliferation. It is a promising candidate for further medicinal development.
| CAS Number | 113852-41-8 |
| Synonyms | 9-(2-phosphonylmethoxyethyl)-2,6-diaminopurine |
| Molecular Formula | C8H13N6O4P |
| Purity | ≥95% |
| Target | HIV |
| Storage | Store at RT |
| IUPAC Name | 2-(2,6-diaminopurin-9-yl)ethoxymethylphosphonic acid |
| InChI | InChI=1S/C8H13N6O4P/c9-6-5-7(13-8(10)12-6)14(3-11-5)1-2-18-4-19(15,16)17/h3H,1-2,4H2,(H2,15,16,17)(H4,9,10,12,13) |
| InChIKey | XHXFQGAZAVKMFF-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1CCOCP(=O)(O)O)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |