For research use only. Not for therapeutic Use.
8-Oxocoptisine（Cat No.:M137188）is a rare natural alkaloid derivative belonging to the protoberberine class, characterized by an oxidized ketone group at the 8-position of the coptisine backbone. Isolated from certain species within the Berberidaceae or Rutaceae families, it exhibits potential pharmacological activities, including antimicrobial, anti-inflammatory, and anticancer effects. The introduction of the 8-oxo functional group enhances its reactivity and may influence binding affinity to biological targets such as DNA or enzymes. As a structurally unique compound, 8-oxocoptisine is of interest in medicinal chemistry for drug development and bioactivity exploration.
| CAS Number | 19716-61-1 |
| Synonyms | 5,7,17,19-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(24),2,4(8),9,15(23),16(20),21-heptaen-14-one |
| Molecular Formula | C19H13NO5 |
| Purity | ≥95% |
| IUPAC Name | 5,7,17,19-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(24),2,4(8),9,15(23),16(20),21-heptaen-14-one |
| InChI | InChI=1S/C19H13NO5/c21-19-17-11(1-2-14-18(17)25-9-22-14)5-13-12-7-16-15(23-8-24-16)6-10(12)3-4-20(13)19/h1-2,5-7H,3-4,8-9H2 |
| InChIKey | UCAFJBSQKXVPDX-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC3=C(C2=O)C4=C(C=C3)OCO4)C5=CC6=C(C=C51)OCO6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
