For research use only. Not for therapeutic Use.
8-Hydroxycoumarin(Cat No.:I045048)is a hydroxylated derivative of coumarin, featuring a hydroxyl group at the 8-position of the benzopyrone core. It exhibits strong fluorescence properties, making it useful as a fluorophore in biochemical assays, molecular probes, and analytical applications. 8-Hydroxycoumarin also displays antioxidant, antimicrobial, and anticoagulant activities, contributing to its relevance in pharmaceutical and biological research. Its ability to chelate metal ions enhances its utility in sensing and imaging applications. This compound serves as a versatile scaffold in drug discovery, fluorescence-based detection systems, and studies of coumarin-related biological activity.
| CAS Number | 2442-31-1 |
| Synonyms | 8-hydroxychromen-2-one |
| Molecular Formula | C9H6O3 |
| Purity | ≥95% |
| IUPAC Name | 8-hydroxychromen-2-one |
| InChI | InChI=1S/C9H6O3/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5,10H |
| InChIKey | DPTUTXWBBUARQB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC(=O)C=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |