For research use only. Not for therapeutic Use.
8-Hydroxybergapten（Cat No.:M047874）is a naturally occurring furanocoumarin derivative found in several medicinal plants, including species of the Apiaceae and Rutaceae families. Structurally, it is a hydroxylated form of bergapten, featuring a furan ring fused to a coumarin backbone. Research suggests this compound may display antioxidant, anti-inflammatory, antimicrobial, and anticancer activities. It is also studied for its ability to modulate enzymatic pathways and influence cell signaling. With its diverse pharmacological potential, 8-Hydroxybergapten has attracted interest in natural product chemistry and therapeutic development against chronic and degenerative diseases.
| CAS Number | 1603-47-0 |
| Synonyms | 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one |
| Molecular Formula | C12H8O5 |
| Purity | ≥95% |
| IUPAC Name | 9-hydroxy-4-methoxyfuro[3,2-g]chromen-7-one |
| InChI | InChI=1S/C12H8O5/c1-15-10-6-2-3-8(13)17-12(6)9(14)11-7(10)4-5-16-11/h2-5,14H,1H3 |
| InChIKey | MVJHUMZXIJPVHV-UHFFFAOYSA-N |
| SMILES | COC1=C2C=COC2=C(C3=C1C=CC(=O)O3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
