For research use only. Not for therapeutic Use.
8-Epiloganic acid(Cat No.:I044814)is a naturally occurring iridoid glycoside, structurally related to loganic acid, and typically found in medicinal plants such as those in the Gentianaceae or Loganiaceae families. It features a cyclopentanopyran ring system with a glucose moiety, contributing to its solubility and bioactivity. Known for its antioxidant, anti-inflammatory, and hepatoprotective properties, 8-epiloganic acid may modulate oxidative stress and support liver function. Its stereochemistry at the C-8 position distinguishes it from loganic acid, influencing its biological interactions. The compound is being explored for its therapeutic potential in herbal medicine and pharmacological research.
CAS Number | 82509-41-9 |
Synonyms | (1S,4aS,6S,7S,7aS)-6-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
Molecular Formula | C16H24O10 |
Purity | ≥95% |
IUPAC Name | (1S,4aS,6S,7S,7aS)-6-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
InChI | InChI=1S/C16H24O10/c1-5-8(18)2-6-7(14(22)23)4-24-15(10(5)6)26-16-13(21)12(20)11(19)9(3-17)25-16/h4-6,8-13,15-21H,2-3H2,1H3,(H,22,23)/t5-,6-,8+,9-,10-,11-,12+,13-,15+,16+/m1/s1 |
InChIKey | JNNGEAWILNVFFD-OZFVSFPVSA-N |
SMILES | C[C@@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |