For research use only. Not for therapeutic Use.
8-Deoxygartanin(Cat No.:R008615)is a naturally occurring xanthone isolated from Garcinia species, known for its promising pharmacological properties. It exhibits potent antioxidant, anti-inflammatory, and anticancer activities by modulating key cellular pathways, including apoptosis and oxidative stress responses. 8-Deoxygartanin also demonstrates antimicrobial and neuroprotective potential, making it a focus of research in drug discovery. Its ability to target multiple biological systems highlights its therapeutic versatility. As a bioactive compound, it holds significant promise for the development of novel treatments in oncology, neurodegenerative diseases, and other health conditions.
CAS Number | 33390-41-9 |
Molecular Formula | C23H24O5 |
Purity | ≥95% |
Target | NF-κB |
Storage | Store at -20°C |
IUPAC Name | 1,3,5-trihydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one |
InChI | InChI=1S/C23H24O5/c1-12(2)8-10-14-19(25)16(11-9-13(3)4)23-18(20(14)26)21(27)15-6-5-7-17(24)22(15)28-23/h5-9,24-26H,10-11H2,1-4H3 |
InChIKey | GVQOVMKBYJKZSY-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(O2)C(=CC=C3)O)CC=C(C)C)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |