For research use only. Not for therapeutic Use.
8-Chloro-octanoic Acid Ethyl Ester (Cat.No:M011355) is a chemical compound used in various organic synthesis processes. Its unique structure, containing an eight-carbon chain with a chlorine atom, lends versatility in creating complex molecules for pharmaceutical and agrochemical applications. This compound serves as a valuable intermediate in the production of diverse chemical compounds.
| CAS Number | 105484-55-7 |
| Molecular Formula | C10H19ClO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 8-chlorooctanoate |
| InChI | InChI=1S/C10H19ClO2/c1-2-13-10(12)8-6-4-3-5-7-9-11/h2-9H2,1H3 |
| InChIKey | HNHPPZMCJLFGRP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCCCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |