For research use only. Not for therapeutic Use.
8-Bromo-7-fluoroisoquinoline(Cat No.:L007762), is a chemical compound with the molecular formula C₉H5BrFN. This compound combines a bromine atom, a fluorine atom, and an isoquinoline framework. Isoquinolines and their derivatives are significant in medicinal chemistry, often serving as key structural motifs in various pharmaceuticals and bioactive compounds. Researchers likely explore this compound’s synthesis, properties, and potential biological activities, aiming for applications in drug development.
CAS Number | 1445891-57-5 |
Molecular Formula | C9H5BrFN |
Purity | ≥95% |
IUPAC Name | 8-bromo-7-fluoroisoquinoline |
InChI | InChI=1S/C9H5BrFN/c10-9-7-5-12-4-3-6(7)1-2-8(9)11/h1-5H |
InChIKey | GDQIFFRWCFFSKB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1C=CN=C2)Br)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |