For research use only. Not for therapeutic Use.
8-Bromo-2′-deoxyadenosine(Cat No.:R041612)is a nucleoside analogue of deoxyadenosine, where a bromine atom replaces the 8-hydrogen of the adenine base. This modification can disrupt normal DNA replication and transcription by inducing DNA damage or altering base pairing. It is often used as a research tool to study DNA repair mechanisms, mutagenesis, and the effects of oxidative stress on cellular processes. 8-Bromo-2′-deoxyadenosine has potential applications in cancer research due to its ability to interfere with DNA synthesis in rapidly dividing cells, leading to cell death or growth inhibition.
CAS Number | 14985-44-5 |
Synonyms | (2R,5R)-5-(6-amino-8-bromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
Molecular Formula | C10H12BrN5O3 |
Purity | ≥95% |
IUPAC Name | (2R,3S,5R)-5-(6-amino-8-bromopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
InChI | InChI=1S/C10H12BrN5O3/c11-10-15-7-8(12)13-3-14-9(7)16(10)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,13,14)/t4-,5+,6+/m0/s1 |
InChIKey | NJBIVXMQFIQOGE-KVQBGUIXSA-N |
SMILES | C1[C@@H]([C@H](O[C@H]1N2C3=NC=NC(=C3N=C2Br)N)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |