For research use only. Not for therapeutic Use.
8-Bromo-1,6-naphthyridin-5-amine(Cat No.:L020701)is a high-purity heterocyclic compound commonly used in pharmaceutical and chemical research. This molecule features a naphthyridine core with a bromine atom at the 8-position and an amino group at the 5-position, making it a versatile intermediate in the synthesis of bioactive compounds, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations. 8-Bromo-1,6-naphthyridin-5-amine is essential for precise synthetic applications, supporting advancements in medicinal chemistry and the development of novel therapeutic agents.
CAS Number | 1820686-20-1 |
Molecular Formula | C8H6BrN3 |
Purity | ≥95% |
IUPAC Name | 8-bromo-1,6-naphthyridin-5-amine |
InChI | InChI=1S/C8H6BrN3/c9-6-4-12-8(10)5-2-1-3-11-7(5)6/h1-4H,(H2,10,12) |
InChIKey | HCBBBKVKWONFFD-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=CN=C2N)Br)N=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |