For research use only. Not for therapeutic Use.
8-Bromo-[1,2,4]triazolo[1,5-a]pyridine(Cat No.:L047418)is a brominated heterocyclic compound used extensively in pharmaceutical research. Its unique triazolopyridine core structure, combined with the bromine atom at the 8-position, makes it a valuable intermediate for synthesizing a wide range of biologically active molecules. This compound is particularly important in developing new therapeutic agents targeting neurological disorders, cancer, and inflammatory conditions. With its high chemical stability and versatility, it serves as a key building block for advancing medicinal chemistry and drug discovery efforts.
| CAS Number | 868362-18-9 |
| Molecular Formula | C6H4BrN3 |
| Purity | ≥95% |
| IUPAC Name | 8-bromo-[1,2,4]triazolo[1,5-a]pyridine |
| InChI | InChI=1S/C6H4BrN3/c7-5-2-1-3-10-6(5)8-4-9-10/h1-4H |
| InChIKey | NATZWIFAAIXCTQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=N2)C(=C1)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |