For research use only. Not for therapeutic Use.
7-Iodo-2′,3′-dideoxy-7-deaza-guanosine（Cat No.:I044740）is a chemically modified guanosine analog featuring iodine substitution at the 7-position and lacking hydroxyl groups at the 2′ and 3′ positions of the sugar moiety. The 7-deaza modification enhances base stability and reduces hydrogen bonding ambiguity, while the iodination facilitates radiolabeling or crosslinking studies. This compound is widely used in nucleic acid research, including studies on antiviral mechanisms, nucleoside analog incorporation, and structure-activity relationships. Its unique structure supports development of therapeutic oligonucleotides and probes for investigating RNA and DNA polymerase function.
| CAS Number | 114748-67-3 |
| Synonyms | 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| Molecular Formula | C11H13IN4O3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChI | InChI=1S/C11H13IN4O3/c12-6-3-16(7-2-1-5(4-17)19-7)9-8(6)10(18)15-11(13)14-9/h3,5,7,17H,1-2,4H2,(H3,13,14,15,18)/t5-,7+/m0/s1 |
| InChIKey | KJNOBXXCZQLWLF-CAHLUQPWSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CO)N2C=C(C3=C2N=C(NC3=O)N)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
